About (1S)-1-phenyl-1,2,3,4-tetrahydroisoquinoline
(1S)-1-phenyl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 1382087) has the molecular formula C15H15N
and a molecular weight of 209.29 g/mol. Its IUPAC name is (1S)-1-phenyl-1,2,3,4-tetrahydroisoquinoline.
Molecular Properties
| Compound Name | (1S)-1-phenyl-1,2,3,4-tetrahydroisoquinoline |
| PubChem CID | 1382087 |
| Molecular Formula | C15H15N |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | (1S)-1-phenyl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | c1ccc([C@@H]2NCCc3ccccc32)cc1 |
| InChI | InChI=1S/C15H15N/c1-2-7-13(8-3-1)15-14-9-5-4-6-12(14)10-11-16-15/h1-9,15-16H,10-11H2/t15-/m0/s1 |
| InChIKey | PRTRSEDVLBBFJZ-HNNXBMFYSA-N |
| XLogP | 2.92 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1S)-1-phenyl-1,2,3,4-tetrahydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-phenyl-1,2,3,4-tetrahydroisoquinoline?
The IUPAC name of (1S)-1-phenyl-1,2,3,4-tetrahydroisoquinoline (CID 1382087) is (1S)-1-phenyl-1,2,3,4-tetrahydroisoquinoline.
What is the SMILES notation for (1S)-1-phenyl-1,2,3,4-tetrahydroisoquinoline?
The canonical SMILES for (1S)-1-phenyl-1,2,3,4-tetrahydroisoquinoline is c1ccc([C@@H]2NCCc3ccccc32)cc1.
What is the InChIKey of (1S)-1-phenyl-1,2,3,4-tetrahydroisoquinoline?
The InChIKey is PRTRSEDVLBBFJZ-HNNXBMFYSA-N. The full InChI is InChI=1S/C15H15N/c1-2-7-13(8-3-1)15-14-9-5-4-6-12(14)10-11-16-15/h1-9,15-16H,10-11H2/t15-/m0/s1.
What are the key properties of (1S)-1-phenyl-1,2,3,4-tetrahydroisoquinoline?
(1S)-1-phenyl-1,2,3,4-tetrahydroisoquinoline has a molecular weight of 209.29 g/mol, XLogP of 2.92, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-phenyl-1,2,3,4-tetrahydroisoquinoline is sourced from PubChem (CID 1382087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).