C16H31O8P — CID 138213596
(1-hexanoyloxy-3-phosphonooxypropan-2-yl) heptanoate (PubChem CID 138213596) has the molecular formula C16H31O8P and a molecular weight of 382.39 g/mol. Its IUPAC name is (1-hexanoyloxy-3-phosphonooxypropan-2-yl) heptanoate.
| Compound Name | (1-hexanoyloxy-3-phosphonooxypropan-2-yl) heptanoate |
|---|---|
| PubChem CID | 138213596 |
| Molecular Formula | C16H31O8P |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | (1-hexanoyloxy-3-phosphonooxypropan-2-yl) heptanoate |
| SMILES | CCCCCCC(=O)OC(COC(=O)CCCCC)COP(=O)(O)O |
| InChI | InChI=1S/C16H31O8P/c1-3-5-7-9-11-16(18)24-14(13-23-25(19,20)21)12-22-15(17)10-8-6-4-2/h14H,3-13H2,1-2H3,(H2,19,20,21) |
| InChIKey | MRHSDQZVWHTDMF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|