C41H76NO10P — CID 138215272
[1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(Z)-octadec-9-enoyl]oxypropan-2-yl] (9Z,11E)-13-hydroperoxyoctadeca-9,11-dienoate (PubChem CID 138215272) has the molecular formula C41H76NO10P and a molecular weight of 774.03 g/mol. Its IUPAC name is [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(Z)-octadec-9-enoyl]oxypropan-2-yl] (9Z,11E)-13-hydroperoxyoctadeca-9,11-dienoate.
| Compound Name | [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(Z)-octadec-9-enoyl]oxypropan-2-yl] (9Z,11E)-13-hydroperoxyoctadeca-9,11-dienoate |
|---|---|
| PubChem CID | 138215272 |
| Molecular Formula | C41H76NO10P |
| Molecular Weight | 774.03 g/mol |
| Exact Mass | 773.52 |
| IUPAC Name | [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(Z)-octadec-9-enoyl]oxypropan-2-yl] (9Z,11E)-13-hydroperoxyoctadeca-9,11-dienoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(COP(=O)(O)OCCN)OC(=O)CCCCCCC/C=C\C=C\C(CCCCC)OO |
| InChI | InChI=1S/C41H76NO10P/c1-3-5-7-8-9-10-11-12-13-14-15-18-21-24-28-32-40(43)48-36-39(37-50-53(46,47)49-35-34-42)51-41(44)33-29-25-22-19-16-17-20-23-27-31-38(52-45)30-26-6-4-2/h12-13,20,23,27,31,38-39,45H,3-11,14-19,21-22,24-26,28-30,32-37,42H2,1-2H3,(H,46,47)/b13-12-,23-20-,31-27+ |
| InChIKey | MWNDOPPVZDJOPF-DYMQBEGYSA-N |
| XLogP | 10.85 |
| TPSA | 163.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.03 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|