C41H68O6 — CID 138225514
2,3-bis[[(Z)-dodec-5-enoyl]oxy]propyl (5Z,8Z,11Z)-tetradeca-5,8,11-trienoate (PubChem CID 138225514) has the molecular formula C41H68O6 and a molecular weight of 656.99 g/mol. Its IUPAC name is 2,3-bis[[(Z)-dodec-5-enoyl]oxy]propyl (5Z,8Z,11Z)-tetradeca-5,8,11-trienoate.
| Compound Name | 2,3-bis[[(Z)-dodec-5-enoyl]oxy]propyl (5Z,8Z,11Z)-tetradeca-5,8,11-trienoate |
|---|---|
| PubChem CID | 138225514 |
| Molecular Formula | C41H68O6 |
| Molecular Weight | 656.99 g/mol |
| Exact Mass | 656.50 |
| IUPAC Name | 2,3-bis[[(Z)-dodec-5-enoyl]oxy]propyl (5Z,8Z,11Z)-tetradeca-5,8,11-trienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCC(=O)OCC(COC(=O)CCC/C=C\CCCCCC)OC(=O)CCC/C=C\CCCCCC |
| InChI | InChI=1S/C41H68O6/c1-4-7-10-13-16-19-20-23-25-28-31-34-40(43)46-37-38(47-41(44)35-32-29-26-22-18-15-12-9-6-3)36-45-39(42)33-30-27-24-21-17-14-11-8-5-2/h7,10,16,19,21-26,38H,4-6,8-9,11-15,17-18,20,27-37H2,1-3H3/b10-7-,19-16-,24-21-,25-23-,26-22- |
| InChIKey | OCSJPKBCKWQJHR-HYCRLRNOSA-N |
| XLogP | 11.41 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.99 |
| LogP ≤ 5 | 11.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|