C44H66O6 — CID 138228172
2,3-bis[[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy]propyl (8Z,11Z,14Z)-heptadeca-8,11,14-trienoate (PubChem CID 138228172) has the molecular formula C44H66O6 and a molecular weight of 691.01 g/mol. Its IUPAC name is 2,3-bis[[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy]propyl (8Z,11Z,14Z)-heptadeca-8,11,14-trienoate.
| Compound Name | 2,3-bis[[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy]propyl (8Z,11Z,14Z)-heptadeca-8,11,14-trienoate |
|---|---|
| PubChem CID | 138228172 |
| Molecular Formula | C44H66O6 |
| Molecular Weight | 691.01 g/mol |
| Exact Mass | 690.49 |
| IUPAC Name | 2,3-bis[[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy]propyl (8Z,11Z,14Z)-heptadeca-8,11,14-trienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCC(=O)OCC(COC(=O)C/C=C\C/C=C\C/C=C\CC)OC(=O)C/C=C\C/C=C\C/C=C\CC |
| InChI | InChI=1S/C44H66O6/c1-4-7-10-13-16-19-20-21-22-23-26-28-31-34-37-43(46)49-40-41(50-44(47)38-35-32-29-25-18-15-12-9-6-3)39-48-42(45)36-33-30-27-24-17-14-11-8-5-2/h7-12,16-19,21-22,24-25,30,32-33,35,41H,4-6,13-15,20,23,26-29,31,34,36-40H2,1-3H3/b10-7-,11-8-,12-9-,19-16-,22-21-,24-17-,25-18-,33-30-,35-32- |
| InChIKey | OKYGIKPNTGWJSO-YGRVKZRWSA-N |
| XLogP | 11.68 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.01 |
| LogP ≤ 5 | 11.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|