C50H76O6 — CID 138231585
[3-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-2-[(6Z,9Z,12Z)-pentadeca-6,9,12-trienoyl]oxypropyl] (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate (PubChem CID 138231585) has the molecular formula C50H76O6 and a molecular weight of 773.15 g/mol. Its IUPAC name is [3-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-2-[(6Z,9Z,12Z)-pentadeca-6,9,12-trienoyl]oxypropyl] (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate.
| Compound Name | [3-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-2-[(6Z,9Z,12Z)-pentadeca-6,9,12-trienoyl]oxypropyl] (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 138231585 |
| Molecular Formula | C50H76O6 |
| Molecular Weight | 773.15 g/mol |
| Exact Mass | 772.56 |
| IUPAC Name | [3-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-2-[(6Z,9Z,12Z)-pentadeca-6,9,12-trienoyl]oxypropyl] (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCC(=O)OC(COC(=O)C/C=C\C/C=C\C/C=C\CC)COC(=O)CCC/C=C\C/C=C\C/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C50H76O6/c1-4-7-10-13-16-19-21-23-24-25-26-27-29-31-34-37-40-43-49(52)55-46-47(45-54-48(51)42-39-36-33-30-18-15-12-9-6-3)56-50(53)44-41-38-35-32-28-22-20-17-14-11-8-5-2/h8-9,11-12,16-20,23-24,26-28,30-32,34,36,39,47H,4-7,10,13-15,21-22,25,29,33,35,37-38,40-46H2,1-3H3/b11-8-,12-9-,19-16-,20-17-,24-23-,27-26-,30-18-,32-28-,34-31-,39-36- |
| InChIKey | OVQRDTQMQXYNTM-MYFPMMMTSA-N |
| XLogP | 13.80 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.15 |
| LogP ≤ 5 | 13.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|