C38H71O13P — CID 138234384
[1-[hydroxy-(2,3,4,5,6-pentahydroxycyclohexyl)oxyphosphoryl]oxy-3-nonanoyloxypropan-2-yl] (Z)-icos-11-enoate (PubChem CID 138234384) has the molecular formula C38H71O13P and a molecular weight of 766.95 g/mol. Its IUPAC name is [1-[hydroxy-(2,3,4,5,6-pentahydroxycyclohexyl)oxyphosphoryl]oxy-3-nonanoyloxypropan-2-yl] (Z)-icos-11-enoate.
| Compound Name | [1-[hydroxy-(2,3,4,5,6-pentahydroxycyclohexyl)oxyphosphoryl]oxy-3-nonanoyloxypropan-2-yl] (Z)-icos-11-enoate |
|---|---|
| PubChem CID | 138234384 |
| Molecular Formula | C38H71O13P |
| Molecular Weight | 766.95 g/mol |
| Exact Mass | 766.46 |
| IUPAC Name | [1-[hydroxy-(2,3,4,5,6-pentahydroxycyclohexyl)oxyphosphoryl]oxy-3-nonanoyloxypropan-2-yl] (Z)-icos-11-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCCC(=O)OC(COC(=O)CCCCCCCC)COP(=O)(O)OC1C(O)C(O)C(O)C(O)C1O |
| InChI | InChI=1S/C38H71O13P/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-20-21-23-25-27-32(40)50-30(28-48-31(39)26-24-22-10-8-6-4-2)29-49-52(46,47)51-38-36(44)34(42)33(41)35(43)37(38)45/h14-15,30,33-38,41-45H,3-13,16-29H2,1-2H3,(H,46,47)/b15-14- |
| InChIKey | PEMUNXHYYCWFMO-PFONDFGASA-N |
| XLogP | 6.33 |
| TPSA | 209.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 52 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.95 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|