C58H90O6 — CID 138235465
[3-[(6Z,9Z)-dodeca-6,9-dienoyl]oxy-2-[(9Z,11Z,13Z)-henicosa-9,11,13-trienoyl]oxypropyl] (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate (PubChem CID 138235465) has the molecular formula C58H90O6 and a molecular weight of 883.35 g/mol. Its IUPAC name is [3-[(6Z,9Z)-dodeca-6,9-dienoyl]oxy-2-[(9Z,11Z,13Z)-henicosa-9,11,13-trienoyl]oxypropyl] (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate.
| Compound Name | [3-[(6Z,9Z)-dodeca-6,9-dienoyl]oxy-2-[(9Z,11Z,13Z)-henicosa-9,11,13-trienoyl]oxypropyl] (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate |
|---|---|
| PubChem CID | 138235465 |
| Molecular Formula | C58H90O6 |
| Molecular Weight | 883.35 g/mol |
| Exact Mass | 882.67 |
| IUPAC Name | [3-[(6Z,9Z)-dodeca-6,9-dienoyl]oxy-2-[(9Z,11Z,13Z)-henicosa-9,11,13-trienoyl]oxypropyl] (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)OCC(COC(=O)CCCC/C=C\C/C=C\CC)OC(=O)CCCCCCC/C=C\C=C/C=C\CCCCCCC |
| InChI | InChI=1S/C58H90O6/c1-4-7-10-13-16-19-21-23-25-27-29-31-32-34-36-39-42-45-48-51-57(60)63-54-55(53-62-56(59)50-47-44-41-38-18-15-12-9-6-3)64-58(61)52-49-46-43-40-37-35-33-30-28-26-24-22-20-17-14-11-8-5-2/h7,9-10,12,16,18-19,22-26,28-31,33-34,36,38,42,45,55H,4-6,8,11,13-15,17,20-21,27,32,35,37,39-41,43-44,46-54H2,1-3H3/b10-7-,12-9-,19-16-,24-22-,25-23-,28-26-,31-29-,33-30-,36-34-,38-18-,45-42- |
| InChIKey | PHTAJUWWLLLKGX-RRLNOXLRSA-N |
| XLogP | 16.70 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 883.35 |
| LogP ≤ 5 | 16.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|