C45H83N2O6P — CID 138239071
[(4E,8E,12E)-3-hydroxy-2-[[(11Z,14Z)-icosa-11,14-dienoyl]amino]icosa-4,8,12-trienyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 138239071) has the molecular formula C45H83N2O6P and a molecular weight of 779.14 g/mol. Its IUPAC name is [(4E,8E,12E)-3-hydroxy-2-[[(11Z,14Z)-icosa-11,14-dienoyl]amino]icosa-4,8,12-trienyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(4E,8E,12E)-3-hydroxy-2-[[(11Z,14Z)-icosa-11,14-dienoyl]amino]icosa-4,8,12-trienyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 138239071 |
| Molecular Formula | C45H83N2O6P |
| Molecular Weight | 779.14 g/mol |
| Exact Mass | 778.60 |
| IUPAC Name | [(4E,8E,12E)-3-hydroxy-2-[[(11Z,14Z)-icosa-11,14-dienoyl]amino]icosa-4,8,12-trienyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCCC(=O)NC(COP(=O)([O-])OCC[N+](C)(C)C)C(O)/C=C/CC/C=C/CC/C=C/CCCCCCC |
| InChI | InChI=1S/C45H83N2O6P/c1-6-8-10-12-14-16-18-20-22-23-25-27-29-31-33-35-37-39-45(49)46-43(42-53-54(50,51)52-41-40-47(3,4)5)44(48)38-36-34-32-30-28-26-24-21-19-17-15-13-11-9-7-2/h14,16,19-22,28,30,36,38,43-44,48H,6-13,15,17-18,23-27,29,31-35,37,39-42H2,1-5H3,(H-,46,49,50,51)/b16-14-,21-19+,22-20-,30-28+,38-36+ |
| InChIKey | PSMOFDHAHUCDLM-RVSBJRTOSA-N |
| XLogP | 11.22 |
| TPSA | 107.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.14 |
| LogP ≤ 5 | 11.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|