C45H76NO11P — CID 138241375
[1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(Z)-octadec-9-enoyl]oxypropan-2-yl] (4E,8E,10E,12Z,14E,19Z)-7,16,17-trihydroxydocosa-4,8,10,12,14,19-hexaenoate (PubChem CID 138241375) has the molecular formula C45H76NO11P and a molecular weight of 838.07 g/mol. Its IUPAC name is [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(Z)-octadec-9-enoyl]oxypropan-2-yl] (4E,8E,10E,12Z,14E,19Z)-7,16,17-trihydroxydocosa-4,8,10,12,14,19-hexaenoate.
| Compound Name | [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(Z)-octadec-9-enoyl]oxypropan-2-yl] (4E,8E,10E,12Z,14E,19Z)-7,16,17-trihydroxydocosa-4,8,10,12,14,19-hexaenoate |
|---|---|
| PubChem CID | 138241375 |
| Molecular Formula | C45H76NO11P |
| Molecular Weight | 838.07 g/mol |
| Exact Mass | 837.52 |
| IUPAC Name | [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(Z)-octadec-9-enoyl]oxypropan-2-yl] (4E,8E,10E,12Z,14E,19Z)-7,16,17-trihydroxydocosa-4,8,10,12,14,19-hexaenoate |
| SMILES | CC/C=C\CC(O)C(O)/C=C/C=C\C=C\C=C\C(O)C/C=C/CCC(=O)OC(COC(=O)CCCCCCC/C=C\CCCCCCCC)COP(=O)(O)OCCN |
| InChI | InChI=1S/C45H76NO11P/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-22-28-34-44(50)54-38-41(39-56-58(52,53)55-37-36-46)57-45(51)35-29-23-26-31-40(47)30-25-20-18-19-21-27-33-43(49)42(48)32-24-6-4-2/h6,12-13,18-21,23-27,30,33,40-43,47-49H,3-5,7-11,14-17,22,28-29,31-32,34-39,46H2,1-2H3,(H,52,53)/b13-12-,20-18+,21-19-,24-6-,26-23+,30-25+,33-27+ |
| InChIKey | PZPKWMNHZWPECX-UPMUWLQGSA-N |
| XLogP | 8.96 |
| TPSA | 195.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.07 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|