C49H80O6 — CID 138242693
[1-[(6Z,9Z)-dodeca-6,9-dienoyl]oxy-3-[(8Z,11Z,14Z)-heptadeca-8,11,14-trienoyl]oxypropan-2-yl] (11Z,14Z)-heptadeca-11,14-dienoate (PubChem CID 138242693) has the molecular formula C49H80O6 and a molecular weight of 765.17 g/mol. Its IUPAC name is [1-[(6Z,9Z)-dodeca-6,9-dienoyl]oxy-3-[(8Z,11Z,14Z)-heptadeca-8,11,14-trienoyl]oxypropan-2-yl] (11Z,14Z)-heptadeca-11,14-dienoate.
| Compound Name | [1-[(6Z,9Z)-dodeca-6,9-dienoyl]oxy-3-[(8Z,11Z,14Z)-heptadeca-8,11,14-trienoyl]oxypropan-2-yl] (11Z,14Z)-heptadeca-11,14-dienoate |
|---|---|
| PubChem CID | 138242693 |
| Molecular Formula | C49H80O6 |
| Molecular Weight | 765.17 g/mol |
| Exact Mass | 764.60 |
| IUPAC Name | [1-[(6Z,9Z)-dodeca-6,9-dienoyl]oxy-3-[(8Z,11Z,14Z)-heptadeca-8,11,14-trienoyl]oxypropan-2-yl] (11Z,14Z)-heptadeca-11,14-dienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCC(=O)OCC(COC(=O)CCCC/C=C\C/C=C\CC)OC(=O)CCCCCCCCC/C=C\C/C=C\CC |
| InChI | InChI=1S/C49H80O6/c1-4-7-10-13-16-19-21-23-25-27-30-33-36-39-42-48(51)54-45-46(44-53-47(50)41-38-35-32-29-18-15-12-9-6-3)55-49(52)43-40-37-34-31-28-26-24-22-20-17-14-11-8-5-2/h7-12,16-20,23,25,29,46H,4-6,13-15,21-22,24,26-28,30-45H2,1-3H3/b10-7-,11-8-,12-9-,19-16-,20-17-,25-23-,29-18- |
| InChIKey | QDUHORQSVVSJQH-FXCJDXRFSA-N |
| XLogP | 14.08 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.17 |
| LogP ≤ 5 | 14.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|