C55H96O6 — CID 138247033
[2-[(10Z,12Z)-octadeca-10,12-dienoyl]oxy-3-[(Z)-tetradec-9-enoyl]oxypropyl] (11Z,14Z)-icosa-11,14-dienoate (PubChem CID 138247033) has the molecular formula C55H96O6 and a molecular weight of 853.37 g/mol. Its IUPAC name is [2-[(10Z,12Z)-octadeca-10,12-dienoyl]oxy-3-[(Z)-tetradec-9-enoyl]oxypropyl] (11Z,14Z)-icosa-11,14-dienoate.
| Compound Name | [2-[(10Z,12Z)-octadeca-10,12-dienoyl]oxy-3-[(Z)-tetradec-9-enoyl]oxypropyl] (11Z,14Z)-icosa-11,14-dienoate |
|---|---|
| PubChem CID | 138247033 |
| Molecular Formula | C55H96O6 |
| Molecular Weight | 853.37 g/mol |
| Exact Mass | 852.72 |
| IUPAC Name | [2-[(10Z,12Z)-octadeca-10,12-dienoyl]oxy-3-[(Z)-tetradec-9-enoyl]oxypropyl] (11Z,14Z)-icosa-11,14-dienoate |
| SMILES | CCCC/C=C\CCCCCCCC(=O)OCC(COC(=O)CCCCCCCCC/C=C\C/C=C\CCCCC)OC(=O)CCCCCCCC/C=C\C=C/CCCCC |
| InChI | InChI=1S/C55H96O6/c1-4-7-10-13-16-19-22-24-26-27-29-30-33-36-39-42-45-48-54(57)60-51-52(50-59-53(56)47-44-41-38-35-32-21-18-15-12-9-6-3)61-55(58)49-46-43-40-37-34-31-28-25-23-20-17-14-11-8-5-2/h15-20,23-26,52H,4-14,21-22,27-51H2,1-3H3/b18-15-,19-16-,20-17-,25-23-,26-24- |
| InChIKey | QRPOPFZHBLQQGM-CIVWDOLXSA-N |
| XLogP | 16.87 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.37 |
| LogP ≤ 5 | 16.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|