C32H56O4 — CID 138250409
(Z)-8-[(9Z,12Z)-hexadeca-9,12-dienoyl]oxyhexadec-9-enoic acid (PubChem CID 138250409) has the molecular formula C32H56O4 and a molecular weight of 504.80 g/mol. Its IUPAC name is (Z)-8-[(9Z,12Z)-hexadeca-9,12-dienoyl]oxyhexadec-9-enoic acid.
| Compound Name | (Z)-8-[(9Z,12Z)-hexadeca-9,12-dienoyl]oxyhexadec-9-enoic acid |
|---|---|
| PubChem CID | 138250409 |
| Molecular Formula | C32H56O4 |
| Molecular Weight | 504.80 g/mol |
| Exact Mass | 504.42 |
| IUPAC Name | (Z)-8-[(9Z,12Z)-hexadeca-9,12-dienoyl]oxyhexadec-9-enoic acid |
| SMILES | CCC/C=C\C/C=C\CCCCCCCC(=O)OC(/C=C\CCCCCC)CCCCCCC(=O)O |
| InChI | InChI=1S/C32H56O4/c1-3-5-7-9-11-12-13-14-15-16-17-19-25-29-32(35)36-30(26-22-18-10-8-6-4-2)27-23-20-21-24-28-31(33)34/h7,9,12-13,22,26,30H,3-6,8,10-11,14-21,23-25,27-29H2,1-2H3,(H,33,34)/b9-7-,13-12-,26-22- |
| InChIKey | RBXKDEFTOXITLO-AMQFRMELSA-N |
| XLogP | 9.88 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.80 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|