C19H30O4 — CID 138252984
2-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxypropanoic acid (PubChem CID 138252984) has the molecular formula C19H30O4 and a molecular weight of 322.45 g/mol. Its IUPAC name is 2-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxypropanoic acid.
| Compound Name | 2-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxypropanoic acid |
|---|---|
| PubChem CID | 138252984 |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | 2-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxypropanoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCC(=O)OC(C)C(=O)O |
| InChI | InChI=1S/C19H30O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-18(20)23-17(2)19(21)22/h4-5,7-8,10-11,17H,3,6,9,12-16H2,1-2H3,(H,21,22)/b5-4-,8-7-,11-10- |
| InChIKey | RJZQJHXRIBIVLA-YSTUJMKBSA-N |
| XLogP | 4.81 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|