C23H45O10P — CID 138254181
[1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-heptanoyloxypropan-2-yl] decanoate (PubChem CID 138254181) has the molecular formula C23H45O10P and a molecular weight of 512.58 g/mol. Its IUPAC name is [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-heptanoyloxypropan-2-yl] decanoate.
| Compound Name | [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-heptanoyloxypropan-2-yl] decanoate |
|---|---|
| PubChem CID | 138254181 |
| Molecular Formula | C23H45O10P |
| Molecular Weight | 512.58 g/mol |
| Exact Mass | 512.28 |
| IUPAC Name | [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-heptanoyloxypropan-2-yl] decanoate |
| SMILES | CCCCCCCCCC(=O)OC(COC(=O)CCCCCC)COP(=O)(O)OCC(O)CO |
| InChI | InChI=1S/C23H45O10P/c1-3-5-7-9-10-11-13-15-23(27)33-21(18-30-22(26)14-12-8-6-4-2)19-32-34(28,29)31-17-20(25)16-24/h20-21,24-25H,3-19H2,1-2H3,(H,28,29) |
| InChIKey | RNNWJSLUJYYRML-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.58 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|