C37H69N2O6P — CID 138254790
[(4E,8E,12E)-3-hydroxy-2-[[(Z)-tridec-8-enoyl]amino]nonadeca-4,8,12-trienyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 138254790) has the molecular formula C37H69N2O6P and a molecular weight of 668.94 g/mol. Its IUPAC name is [(4E,8E,12E)-3-hydroxy-2-[[(Z)-tridec-8-enoyl]amino]nonadeca-4,8,12-trienyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(4E,8E,12E)-3-hydroxy-2-[[(Z)-tridec-8-enoyl]amino]nonadeca-4,8,12-trienyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 138254790 |
| Molecular Formula | C37H69N2O6P |
| Molecular Weight | 668.94 g/mol |
| Exact Mass | 668.49 |
| IUPAC Name | [(4E,8E,12E)-3-hydroxy-2-[[(Z)-tridec-8-enoyl]amino]nonadeca-4,8,12-trienyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCC/C=C\CCCCCCC(=O)NC(COP(=O)([O-])OCC[N+](C)(C)C)C(O)/C=C/CC/C=C/CC/C=C/CCCCCC |
| InChI | InChI=1S/C37H69N2O6P/c1-6-8-10-12-14-16-18-19-20-21-22-24-26-28-30-36(40)35(34-45-46(42,43)44-33-32-39(3,4)5)38-37(41)31-29-27-25-23-17-15-13-11-9-7-2/h13,15-16,18,21-22,28,30,35-36,40H,6-12,14,17,19-20,23-27,29,31-34H2,1-5H3,(H-,38,41,42,43)/b15-13-,18-16+,22-21+,30-28+ |
| InChIKey | RPLREFNLRPTYHY-PATRWOACSA-N |
| XLogP | 8.33 |
| TPSA | 107.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.94 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|