C45H79O8P — CID 138257152
[3-[hydroxy(methoxy)phosphoryl]oxy-2-[(11Z,14Z,17Z)-icosa-11,14,17-trienoyl]oxypropyl] (11Z,14Z)-henicosa-11,14-dienoate (PubChem CID 138257152) has the molecular formula C45H79O8P and a molecular weight of 779.09 g/mol. Its IUPAC name is [3-[hydroxy(methoxy)phosphoryl]oxy-2-[(11Z,14Z,17Z)-icosa-11,14,17-trienoyl]oxypropyl] (11Z,14Z)-henicosa-11,14-dienoate.
| Compound Name | [3-[hydroxy(methoxy)phosphoryl]oxy-2-[(11Z,14Z,17Z)-icosa-11,14,17-trienoyl]oxypropyl] (11Z,14Z)-henicosa-11,14-dienoate |
|---|---|
| PubChem CID | 138257152 |
| Molecular Formula | C45H79O8P |
| Molecular Weight | 779.09 g/mol |
| Exact Mass | 778.55 |
| IUPAC Name | [3-[hydroxy(methoxy)phosphoryl]oxy-2-[(11Z,14Z,17Z)-icosa-11,14,17-trienoyl]oxypropyl] (11Z,14Z)-henicosa-11,14-dienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC/C=C\C/C=C\CCCCCC)COP(=O)(O)OC |
| InChI | InChI=1S/C45H79O8P/c1-4-6-8-10-12-14-16-18-20-22-24-25-27-29-31-33-35-37-39-44(46)51-41-43(42-52-54(48,49)50-3)53-45(47)40-38-36-34-32-30-28-26-23-21-19-17-15-13-11-9-7-5-2/h7,9,13-16,19-22,43H,4-6,8,10-12,17-18,23-42H2,1-3H3,(H,48,49)/b9-7-,15-13-,16-14-,21-19-,22-20- |
| InChIKey | RWSKQKLGKOBQSH-PLCAWLAJSA-N |
| XLogP | 13.56 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.09 |
| LogP ≤ 5 | 13.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|