C17H33O10P — CID 138264441
[1-butanoyloxy-3-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxypropan-2-yl] heptanoate (PubChem CID 138264441) has the molecular formula C17H33O10P and a molecular weight of 428.42 g/mol. Its IUPAC name is [1-butanoyloxy-3-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxypropan-2-yl] heptanoate.
| Compound Name | [1-butanoyloxy-3-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxypropan-2-yl] heptanoate |
|---|---|
| PubChem CID | 138264441 |
| Molecular Formula | C17H33O10P |
| Molecular Weight | 428.42 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | [1-butanoyloxy-3-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxypropan-2-yl] heptanoate |
| SMILES | CCCCCCC(=O)OC(COC(=O)CCC)COP(=O)(O)OCC(O)CO |
| InChI | InChI=1S/C17H33O10P/c1-3-5-6-7-9-17(21)27-15(12-24-16(20)8-4-2)13-26-28(22,23)25-11-14(19)10-18/h14-15,18-19H,3-13H2,1-2H3,(H,22,23) |
| InChIKey | SSWUQQHAOYFUDG-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.42 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|