C32H60NO10P — CID 138268613
2-amino-3-[hydroxy-[2-[(Z)-pentadec-9-enoyl]oxy-3-undecanoyloxypropoxy]phosphoryl]oxypropanoic acid (PubChem CID 138268613) has the molecular formula C32H60NO10P and a molecular weight of 649.80 g/mol. Its IUPAC name is 2-amino-3-[hydroxy-[2-[(Z)-pentadec-9-enoyl]oxy-3-undecanoyloxypropoxy]phosphoryl]oxypropanoic acid.
| Compound Name | 2-amino-3-[hydroxy-[2-[(Z)-pentadec-9-enoyl]oxy-3-undecanoyloxypropoxy]phosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 138268613 |
| Molecular Formula | C32H60NO10P |
| Molecular Weight | 649.80 g/mol |
| Exact Mass | 649.40 |
| IUPAC Name | 2-amino-3-[hydroxy-[2-[(Z)-pentadec-9-enoyl]oxy-3-undecanoyloxypropoxy]phosphoryl]oxypropanoic acid |
| SMILES | CCCCC/C=C\CCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC)COP(=O)(O)OCC(N)C(=O)O |
| InChI | InChI=1S/C32H60NO10P/c1-3-5-7-9-11-13-14-15-16-18-20-22-24-31(35)43-28(26-41-44(38,39)42-27-29(33)32(36)37)25-40-30(34)23-21-19-17-12-10-8-6-4-2/h11,13,28-29H,3-10,12,14-27,33H2,1-2H3,(H,36,37)(H,38,39)/b13-11- |
| InChIKey | TZSDQCROVNBCMB-QBFSEMIESA-N |
| XLogP | 7.38 |
| TPSA | 171.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.80 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|