C50H90NO7P — CID 138271764
[3-[(10Z,13Z,16Z)-docosa-10,13,16-trienoxy]-2-[(11Z,14Z,17Z)-icosa-11,14,17-trienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 138271764) has the molecular formula C50H90NO7P and a molecular weight of 848.24 g/mol. Its IUPAC name is [3-[(10Z,13Z,16Z)-docosa-10,13,16-trienoxy]-2-[(11Z,14Z,17Z)-icosa-11,14,17-trienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [3-[(10Z,13Z,16Z)-docosa-10,13,16-trienoxy]-2-[(11Z,14Z,17Z)-icosa-11,14,17-trienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 138271764 |
| Molecular Formula | C50H90NO7P |
| Molecular Weight | 848.24 g/mol |
| Exact Mass | 847.65 |
| IUPAC Name | [3-[(10Z,13Z,16Z)-docosa-10,13,16-trienoxy]-2-[(11Z,14Z,17Z)-icosa-11,14,17-trienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCCCC(=O)OC(COCCCCCCCCC/C=C\C/C=C\C/C=C\CCCCC)COP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C50H90NO7P/c1-6-8-10-12-14-16-18-20-22-24-25-26-28-30-32-34-36-38-40-42-45-55-47-49(48-57-59(53,54)56-46-44-51(3,4)5)58-50(52)43-41-39-37-35-33-31-29-27-23-21-19-17-15-13-11-9-7-2/h9,11,14-17,20-23,25-26,49H,6-8,10,12-13,18-19,24,27-48H2,1-5H3/b11-9-,16-14-,17-15-,22-20-,23-21-,26-25- |
| InChIKey | UJIWSECLGYMTBF-UCZCGFQPSA-N |
| XLogP | 13.64 |
| TPSA | 94.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 848.24 |
| LogP ≤ 5 | 13.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|