C55H94O15 — CID 138271986
[2-[(8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoyl]oxy-3-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxypropyl] (Z)-icos-11-enoate (PubChem CID 138271986) has the molecular formula C55H94O15 and a molecular weight of 995.34 g/mol. Its IUPAC name is [2-[(8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoyl]oxy-3-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxypropyl] (Z)-icos-11-enoate.
| Compound Name | [2-[(8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoyl]oxy-3-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxypropyl] (Z)-icos-11-enoate |
|---|---|
| PubChem CID | 138271986 |
| Molecular Formula | C55H94O15 |
| Molecular Weight | 995.34 g/mol |
| Exact Mass | 994.66 |
| IUPAC Name | [2-[(8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoyl]oxy-3-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxypropyl] (Z)-icos-11-enoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCCCCCC(=O)OC(COC(=O)CCCCCCCCC/C=C\CCCCCCCC)COC1OC(COC2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O |
| InChI | InChI=1S/C55H94O15/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-46(57)65-40-43(68-47(58)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2)41-66-54-53(64)51(62)49(60)45(70-54)42-67-55-52(63)50(61)48(59)44(39-56)69-55/h6,8,12,14,17-20,24,26,43-45,48-56,59-64H,3-5,7,9-11,13,15-16,21-23,25,27-42H2,1-2H3/b8-6-,14-12-,19-17-,20-18-,26-24- |
| InChIKey | UKACRYUVUKWSDC-QWBVDZTBSA-N |
| XLogP | 8.05 |
| TPSA | 231.13 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 70 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 995.34 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|