C52H93O13P — CID 138276813
[1-[(Z)-henicos-11-enoyl]oxy-3-[hydroxy-(2,3,4,5,6-pentahydroxycyclohexyl)oxyphosphoryl]oxypropan-2-yl] (10Z,13Z,16Z)-docosa-10,13,16-trienoate (PubChem CID 138276813) has the molecular formula C52H93O13P and a molecular weight of 957.28 g/mol. Its IUPAC name is [1-[(Z)-henicos-11-enoyl]oxy-3-[hydroxy-(2,3,4,5,6-pentahydroxycyclohexyl)oxyphosphoryl]oxypropan-2-yl] (10Z,13Z,16Z)-docosa-10,13,16-trienoate.
| Compound Name | [1-[(Z)-henicos-11-enoyl]oxy-3-[hydroxy-(2,3,4,5,6-pentahydroxycyclohexyl)oxyphosphoryl]oxypropan-2-yl] (10Z,13Z,16Z)-docosa-10,13,16-trienoate |
|---|---|
| PubChem CID | 138276813 |
| Molecular Formula | C52H93O13P |
| Molecular Weight | 957.28 g/mol |
| Exact Mass | 956.64 |
| IUPAC Name | [1-[(Z)-henicos-11-enoyl]oxy-3-[hydroxy-(2,3,4,5,6-pentahydroxycyclohexyl)oxyphosphoryl]oxypropan-2-yl] (10Z,13Z,16Z)-docosa-10,13,16-trienoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC/C=C\CCCCCCCCC)COP(=O)(O)OC1C(O)C(O)C(O)C(O)C1O |
| InChI | InChI=1S/C52H93O13P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-39-41-46(54)64-44(43-63-66(60,61)65-52-50(58)48(56)47(55)49(57)51(52)59)42-62-45(53)40-38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11,13,17,19-20,22-23,25,44,47-52,55-59H,3-10,12,14-16,18,21,24,26-43H2,1-2H3,(H,60,61)/b13-11-,19-17-,22-20-,25-23- |
| InChIKey | UZEYFMXYSIAHJC-BXTJNSCGSA-N |
| XLogP | 11.12 |
| TPSA | 209.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 66 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 957.28 |
| LogP ≤ 5 | 11.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|