C17H33O12P — CID 138280883
[2-hydroxy-3-[hydroxy-(2,3,4,5,6-pentahydroxycyclohexyl)oxyphosphoryl]oxypropyl] octanoate (PubChem CID 138280883) has the molecular formula C17H33O12P and a molecular weight of 460.41 g/mol. Its IUPAC name is [2-hydroxy-3-[hydroxy-(2,3,4,5,6-pentahydroxycyclohexyl)oxyphosphoryl]oxypropyl] octanoate.
| Compound Name | [2-hydroxy-3-[hydroxy-(2,3,4,5,6-pentahydroxycyclohexyl)oxyphosphoryl]oxypropyl] octanoate |
|---|---|
| PubChem CID | 138280883 |
| Molecular Formula | C17H33O12P |
| Molecular Weight | 460.41 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | [2-hydroxy-3-[hydroxy-(2,3,4,5,6-pentahydroxycyclohexyl)oxyphosphoryl]oxypropyl] octanoate |
| SMILES | CCCCCCCC(=O)OCC(O)COP(=O)(O)OC1C(O)C(O)C(O)C(O)C1O |
| InChI | InChI=1S/C17H33O12P/c1-2-3-4-5-6-7-11(19)27-8-10(18)9-28-30(25,26)29-17-15(23)13(21)12(20)14(22)16(17)24/h10,12-18,20-24H,2-9H2,1H3,(H,25,26) |
| InChIKey | VLNIYXYWZJMULL-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 203.44 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.41 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|