C39H75NO8P+ — CID 138281147
2-[hydroxy-[2-[(Z)-octadec-9-enoyl]oxy-3-[(Z)-tridec-9-enoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium (PubChem CID 138281147) has the molecular formula C39H75NO8P+ and a molecular weight of 717.00 g/mol. Its IUPAC name is 2-[hydroxy-[2-[(Z)-octadec-9-enoyl]oxy-3-[(Z)-tridec-9-enoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-[2-[(Z)-octadec-9-enoyl]oxy-3-[(Z)-tridec-9-enoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 138281147 |
| Molecular Formula | C39H75NO8P+ |
| Molecular Weight | 717.00 g/mol |
| Exact Mass | 716.52 |
| IUPAC Name | 2-[hydroxy-[2-[(Z)-octadec-9-enoyl]oxy-3-[(Z)-tridec-9-enoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCC/C=C\CCCCCCCC(=O)OCC(COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C39H74NO8P/c1-6-8-10-12-14-16-18-19-20-21-22-24-26-28-30-32-39(42)48-37(36-47-49(43,44)46-34-33-40(3,4)5)35-45-38(41)31-29-27-25-23-17-15-13-11-9-7-2/h11,13,19-20,37H,6-10,12,14-18,21-36H2,1-5H3/p+1/b13-11-,20-19- |
| InChIKey | VMIWRTPSKVEXLK-KCGKQNOWSA-O |
| XLogP | 10.41 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.00 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|