C49H76O6 — CID 138282711
[2-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-3-[(Z)-dodec-5-enoyl]oxypropyl] (7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoate (PubChem CID 138282711) has the molecular formula C49H76O6 and a molecular weight of 761.14 g/mol. Its IUPAC name is [2-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-3-[(Z)-dodec-5-enoyl]oxypropyl] (7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoate.
| Compound Name | [2-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-3-[(Z)-dodec-5-enoyl]oxypropyl] (7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoate |
|---|---|
| PubChem CID | 138282711 |
| Molecular Formula | C49H76O6 |
| Molecular Weight | 761.14 g/mol |
| Exact Mass | 760.56 |
| IUPAC Name | [2-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-3-[(Z)-dodec-5-enoyl]oxypropyl] (7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCCC(=O)OCC(COC(=O)CCC/C=C\CCCCCC)OC(=O)C/C=C\C/C=C\C/C=C\CC |
| InChI | InChI=1S/C49H76O6/c1-4-7-10-13-16-19-20-21-22-23-24-25-26-27-28-31-33-36-39-42-48(51)54-45-46(55-49(52)43-40-37-34-30-18-15-12-9-6-3)44-53-47(50)41-38-35-32-29-17-14-11-8-5-2/h7,9-10,12,16,18-19,21-22,24-25,27-30,32,37,40,46H,4-6,8,11,13-15,17,20,23,26,31,33-36,38-39,41-45H2,1-3H3/b10-7-,12-9-,19-16-,22-21-,25-24-,28-27-,30-18-,32-29-,40-37- |
| InChIKey | VRIAJUGELUNGLH-OYTHTDIMSA-N |
| XLogP | 13.63 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.14 |
| LogP ≤ 5 | 13.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|