C38H72NO8P — CID 138283199
[2-[(Z)-heptadec-9-enoyl]oxy-3-[(Z)-tridec-9-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 138283199) has the molecular formula C38H72NO8P and a molecular weight of 701.97 g/mol. Its IUPAC name is [2-[(Z)-heptadec-9-enoyl]oxy-3-[(Z)-tridec-9-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [2-[(Z)-heptadec-9-enoyl]oxy-3-[(Z)-tridec-9-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 138283199 |
| Molecular Formula | C38H72NO8P |
| Molecular Weight | 701.97 g/mol |
| Exact Mass | 701.50 |
| IUPAC Name | [2-[(Z)-heptadec-9-enoyl]oxy-3-[(Z)-tridec-9-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCC/C=C\CCCCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCC/C=C\CCCCCCC |
| InChI | InChI=1S/C38H72NO8P/c1-6-8-10-12-14-16-18-19-20-21-23-25-27-29-31-38(41)47-36(35-46-48(42,43)45-33-32-39(3,4)5)34-44-37(40)30-28-26-24-22-17-15-13-11-9-7-2/h11,13,18-19,36H,6-10,12,14-17,20-35H2,1-5H3/b13-11-,19-18- |
| InChIKey | VSYHCONNDULQTG-ALNYRUPPSA-N |
| XLogP | 9.38 |
| TPSA | 111.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.97 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|