C33H52NO4+ — CID 138284223
[3-carboxy-2-[(5E,8E,11Z,14Z,17E,20E,23E)-hexacosa-5,8,11,14,17,20,23-heptaenoyl]oxypropyl]-trimethylazanium (PubChem CID 138284223) has the molecular formula C33H52NO4+ and a molecular weight of 526.78 g/mol. Its IUPAC name is [3-carboxy-2-[(5E,8E,11Z,14Z,17E,20E,23E)-hexacosa-5,8,11,14,17,20,23-heptaenoyl]oxypropyl]-trimethylazanium.
| Compound Name | [3-carboxy-2-[(5E,8E,11Z,14Z,17E,20E,23E)-hexacosa-5,8,11,14,17,20,23-heptaenoyl]oxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 138284223 |
| Molecular Formula | C33H52NO4+ |
| Molecular Weight | 526.78 g/mol |
| Exact Mass | 526.39 |
| IUPAC Name | [3-carboxy-2-[(5E,8E,11Z,14Z,17E,20E,23E)-hexacosa-5,8,11,14,17,20,23-heptaenoyl]oxypropyl]-trimethylazanium |
| SMILES | CC/C=C/C/C=C/C/C=C/C/C=C\C/C=C\C/C=C/C/C=C/CCCC(=O)OC(CC(=O)O)C[N+](C)(C)C |
| InChI | InChI=1S/C33H51NO4/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28-33(37)38-31(29-32(35)36)30-34(2,3)4/h6-7,9-10,12-13,15-16,18-19,21-22,24-25,31H,5,8,11,14,17,20,23,26-30H2,1-4H3/p+1/b7-6+,10-9+,13-12+,16-15-,19-18-,22-21+,25-24+ |
| InChIKey | VVZRJXJVFDOEAW-WRMISEQNSA-O |
| XLogP | 7.89 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.78 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|