C35H65NO3 — CID 138284729
(11Z,14Z)-N-[(E)-1,3-dihydroxypentadec-4-en-2-yl]icosa-11,14-dienamide (PubChem CID 138284729) has the molecular formula C35H65NO3 and a molecular weight of 547.91 g/mol. Its IUPAC name is (11Z,14Z)-N-[(E)-1,3-dihydroxypentadec-4-en-2-yl]icosa-11,14-dienamide.
| Compound Name | (11Z,14Z)-N-[(E)-1,3-dihydroxypentadec-4-en-2-yl]icosa-11,14-dienamide |
|---|---|
| PubChem CID | 138284729 |
| Molecular Formula | C35H65NO3 |
| Molecular Weight | 547.91 g/mol |
| Exact Mass | 547.50 |
| IUPAC Name | (11Z,14Z)-N-[(E)-1,3-dihydroxypentadec-4-en-2-yl]icosa-11,14-dienamide |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCCC(=O)NC(CO)C(O)/C=C/CCCCCCCCCC |
| InChI | InChI=1S/C35H65NO3/c1-3-5-7-9-11-13-15-16-17-18-19-20-21-23-25-27-29-31-35(39)36-33(32-37)34(38)30-28-26-24-22-14-12-10-8-6-4-2/h11,13,16-17,28,30,33-34,37-38H,3-10,12,14-15,18-27,29,31-32H2,1-2H3,(H,36,39)/b13-11-,17-16-,30-28+ |
| InChIKey | VXMOJVVMRWTUKL-FNUNVXLFSA-N |
| XLogP | 9.51 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.91 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|