C49H78O6 — CID 138285191
[2-[(6Z,9Z,12Z)-pentadeca-6,9,12-trienoyl]oxy-3-[(5Z,8Z,11Z)-tetradeca-5,8,11-trienoyl]oxypropyl] (11Z,14Z)-heptadeca-11,14-dienoate (PubChem CID 138285191) has the molecular formula C49H78O6 and a molecular weight of 763.16 g/mol. Its IUPAC name is [2-[(6Z,9Z,12Z)-pentadeca-6,9,12-trienoyl]oxy-3-[(5Z,8Z,11Z)-tetradeca-5,8,11-trienoyl]oxypropyl] (11Z,14Z)-heptadeca-11,14-dienoate.
| Compound Name | [2-[(6Z,9Z,12Z)-pentadeca-6,9,12-trienoyl]oxy-3-[(5Z,8Z,11Z)-tetradeca-5,8,11-trienoyl]oxypropyl] (11Z,14Z)-heptadeca-11,14-dienoate |
|---|---|
| PubChem CID | 138285191 |
| Molecular Formula | C49H78O6 |
| Molecular Weight | 763.16 g/mol |
| Exact Mass | 762.58 |
| IUPAC Name | [2-[(6Z,9Z,12Z)-pentadeca-6,9,12-trienoyl]oxy-3-[(5Z,8Z,11Z)-tetradeca-5,8,11-trienoyl]oxypropyl] (11Z,14Z)-heptadeca-11,14-dienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCC(=O)OC(COC(=O)CCC/C=C\C/C=C\C/C=C\CC)COC(=O)CCCCCCCCC/C=C\C/C=C\CC |
| InChI | InChI=1S/C49H78O6/c1-4-7-10-13-16-19-22-24-25-28-30-33-36-39-42-48(51)54-45-46(44-53-47(50)41-38-35-32-29-26-21-18-15-12-9-6-3)55-49(52)43-40-37-34-31-27-23-20-17-14-11-8-5-2/h7-12,16-21,27,29,31-32,46H,4-6,13-15,22-26,28,30,33-45H2,1-3H3/b10-7-,11-8-,12-9-,19-16-,20-17-,21-18-,31-27-,32-29- |
| InChIKey | VYWSEGQEWSREFF-ZGPONFFRSA-N |
| XLogP | 13.86 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.16 |
| LogP ≤ 5 | 13.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|