C41H75O8P — CID 138286209
[1-[(Z)-hexadec-9-enoyl]oxy-3-[hydroxy(methoxy)phosphoryl]oxypropan-2-yl] (11Z,14Z)-henicosa-11,14-dienoate (PubChem CID 138286209) has the molecular formula C41H75O8P and a molecular weight of 727.02 g/mol. Its IUPAC name is [1-[(Z)-hexadec-9-enoyl]oxy-3-[hydroxy(methoxy)phosphoryl]oxypropan-2-yl] (11Z,14Z)-henicosa-11,14-dienoate.
| Compound Name | [1-[(Z)-hexadec-9-enoyl]oxy-3-[hydroxy(methoxy)phosphoryl]oxypropan-2-yl] (11Z,14Z)-henicosa-11,14-dienoate |
|---|---|
| PubChem CID | 138286209 |
| Molecular Formula | C41H75O8P |
| Molecular Weight | 727.02 g/mol |
| Exact Mass | 726.52 |
| IUPAC Name | [1-[(Z)-hexadec-9-enoyl]oxy-3-[hydroxy(methoxy)phosphoryl]oxypropan-2-yl] (11Z,14Z)-henicosa-11,14-dienoate |
| SMILES | CCCCCC/C=C\C/C=C\CCCCCCCCCC(=O)OC(COC(=O)CCCCCCC/C=C\CCCCCC)COP(=O)(O)OC |
| InChI | InChI=1S/C41H75O8P/c1-4-6-8-10-12-14-16-18-19-20-21-22-24-26-28-30-32-34-36-41(43)49-39(38-48-50(44,45)46-3)37-47-40(42)35-33-31-29-27-25-23-17-15-13-11-9-7-5-2/h14-17,19-20,39H,4-13,18,21-38H2,1-3H3,(H,44,45)/b16-14-,17-15-,20-19- |
| InChIKey | WBZPJULXTQHCGU-PMTUPECQSA-N |
| XLogP | 12.45 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.02 |
| LogP ≤ 5 | 12.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|