C43H77O10P — CID 138286803
[3-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-2-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxypropyl] (Z)-henicos-11-enoate (PubChem CID 138286803) has the molecular formula C43H77O10P and a molecular weight of 785.05 g/mol. Its IUPAC name is [3-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-2-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxypropyl] (Z)-henicos-11-enoate.
| Compound Name | [3-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-2-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxypropyl] (Z)-henicos-11-enoate |
|---|---|
| PubChem CID | 138286803 |
| Molecular Formula | C43H77O10P |
| Molecular Weight | 785.05 g/mol |
| Exact Mass | 784.53 |
| IUPAC Name | [3-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-2-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxypropyl] (Z)-henicos-11-enoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCC(=O)OC(COC(=O)CCCCCCCCC/C=C\CCCCCCCCC)COP(=O)(O)OCC(O)CO |
| InChI | InChI=1S/C43H77O10P/c1-3-5-7-9-11-13-15-17-18-19-20-21-23-24-26-28-30-32-34-42(46)50-38-41(39-52-54(48,49)51-37-40(45)36-44)53-43(47)35-33-31-29-27-25-22-16-14-12-10-8-6-4-2/h6,8,12,14,18-19,22,25,40-41,44-45H,3-5,7,9-11,13,15-17,20-21,23-24,26-39H2,1-2H3,(H,48,49)/b8-6-,14-12-,19-18-,25-22- |
| InChIKey | WDYLGNOSOKNHMU-JMIAEFBZSA-N |
| XLogP | 10.95 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.05 |
| LogP ≤ 5 | 10.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|