C50H90O15 — CID 138287381
[1-[(Z)-heptadec-9-enoyl]oxy-3-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxypropan-2-yl] (Z)-octadec-9-enoate (PubChem CID 138287381) has the molecular formula C50H90O15 and a molecular weight of 931.25 g/mol. Its IUPAC name is [1-[(Z)-heptadec-9-enoyl]oxy-3-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxypropan-2-yl] (Z)-octadec-9-enoate.
| Compound Name | [1-[(Z)-heptadec-9-enoyl]oxy-3-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxypropan-2-yl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 138287381 |
| Molecular Formula | C50H90O15 |
| Molecular Weight | 931.25 g/mol |
| Exact Mass | 930.63 |
| IUPAC Name | [1-[(Z)-heptadec-9-enoyl]oxy-3-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxypropan-2-yl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCC/C=C\CCCCCCCC(=O)OCC(COC1OC(COC2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O)OC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C50H90O15/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-42(53)63-38(35-60-41(52)32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2)36-61-49-48(59)46(57)44(55)40(65-49)37-62-50-47(58)45(56)43(54)39(34-51)64-50/h16-19,38-40,43-51,54-59H,3-15,20-37H2,1-2H3/b18-16-,19-17- |
| InChIKey | WFWAKVMGHHQHIA-YGGBKCGDSA-N |
| XLogP | 6.77 |
| TPSA | 231.13 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 65 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 931.25 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|