C13H29NO7P+ — CID 138287973
2-[hydroxy-(2-hydroxy-3-pentanoyloxypropoxy)phosphoryl]oxyethyl-trimethylazanium (PubChem CID 138287973) has the molecular formula C13H29NO7P+ and a molecular weight of 342.35 g/mol. Its IUPAC name is 2-[hydroxy-(2-hydroxy-3-pentanoyloxypropoxy)phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-(2-hydroxy-3-pentanoyloxypropoxy)phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 138287973 |
| Molecular Formula | C13H29NO7P+ |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 2-[hydroxy-(2-hydroxy-3-pentanoyloxypropoxy)phosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCC(=O)OCC(O)COP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C13H28NO7P/c1-5-6-7-13(16)19-10-12(15)11-21-22(17,18)20-9-8-14(2,3)4/h12,15H,5-11H2,1-4H3/p+1 |
| InChIKey | WHRCNWNTUHVMQU-UHFFFAOYSA-O |
| XLogP | 0.92 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|