C35H67NO4 — CID 138288194
(Z)-N-[(E)-1,3,4-trihydroxypentadec-8-en-2-yl]icos-11-enamide (PubChem CID 138288194) has the molecular formula C35H67NO4 and a molecular weight of 565.92 g/mol. Its IUPAC name is (Z)-N-[(E)-1,3,4-trihydroxypentadec-8-en-2-yl]icos-11-enamide.
| Compound Name | (Z)-N-[(E)-1,3,4-trihydroxypentadec-8-en-2-yl]icos-11-enamide |
|---|---|
| PubChem CID | 138288194 |
| Molecular Formula | C35H67NO4 |
| Molecular Weight | 565.92 g/mol |
| Exact Mass | 565.51 |
| IUPAC Name | (Z)-N-[(E)-1,3,4-trihydroxypentadec-8-en-2-yl]icos-11-enamide |
| SMILES | CCCCCC/C=C/CCCC(O)C(O)C(CO)NC(=O)CCCCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C35H67NO4/c1-3-5-7-9-11-13-14-15-16-17-18-19-20-22-24-26-28-30-34(39)36-32(31-37)35(40)33(38)29-27-25-23-21-12-10-8-6-4-2/h15-16,21,23,32-33,35,37-38,40H,3-14,17-20,22,24-31H2,1-2H3,(H,36,39)/b16-15-,23-21+ |
| InChIKey | WIIDHGWNBLUAFY-UNYJLYLKSA-N |
| XLogP | 8.70 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.92 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|