C52H86O6 — CID 138293367
[2-[(5Z,8Z,11Z)-tetradeca-5,8,11-trienoyl]oxy-3-[(Z)-tetradec-9-enoyl]oxypropyl] (9Z,11Z,13Z)-henicosa-9,11,13-trienoate (PubChem CID 138293367) has the molecular formula C52H86O6 and a molecular weight of 807.25 g/mol. Its IUPAC name is [2-[(5Z,8Z,11Z)-tetradeca-5,8,11-trienoyl]oxy-3-[(Z)-tetradec-9-enoyl]oxypropyl] (9Z,11Z,13Z)-henicosa-9,11,13-trienoate.
| Compound Name | [2-[(5Z,8Z,11Z)-tetradeca-5,8,11-trienoyl]oxy-3-[(Z)-tetradec-9-enoyl]oxypropyl] (9Z,11Z,13Z)-henicosa-9,11,13-trienoate |
|---|---|
| PubChem CID | 138293367 |
| Molecular Formula | C52H86O6 |
| Molecular Weight | 807.25 g/mol |
| Exact Mass | 806.64 |
| IUPAC Name | [2-[(5Z,8Z,11Z)-tetradeca-5,8,11-trienoyl]oxy-3-[(Z)-tetradec-9-enoyl]oxypropyl] (9Z,11Z,13Z)-henicosa-9,11,13-trienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCC(=O)OC(COC(=O)CCCCCCC/C=C\C=C/C=C\CCCCCCC)COC(=O)CCCCCCC/C=C\CCCC |
| InChI | InChI=1S/C52H86O6/c1-4-7-10-13-16-19-22-23-24-25-26-27-28-31-33-36-39-42-45-51(54)57-48-49(58-52(55)46-43-40-37-34-30-21-18-15-12-9-6-3)47-56-50(53)44-41-38-35-32-29-20-17-14-11-8-5-2/h9,12,14,17-18,21-27,34,37,49H,4-8,10-11,13,15-16,19-20,28-33,35-36,38-48H2,1-3H3/b12-9-,17-14-,21-18-,23-22-,25-24-,27-26-,37-34- |
| InChIKey | WYROHJQFAAXALS-HXYSEYEISA-N |
| XLogP | 15.25 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.25 |
| LogP ≤ 5 | 15.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|