C28H46O10 — CID 138293546
[1-propanoyloxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (7Z,10Z,13Z)-hexadeca-7,10,13-trienoate (PubChem CID 138293546) has the molecular formula C28H46O10 and a molecular weight of 542.67 g/mol. Its IUPAC name is [1-propanoyloxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (7Z,10Z,13Z)-hexadeca-7,10,13-trienoate.
| Compound Name | [1-propanoyloxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (7Z,10Z,13Z)-hexadeca-7,10,13-trienoate |
|---|---|
| PubChem CID | 138293546 |
| Molecular Formula | C28H46O10 |
| Molecular Weight | 542.67 g/mol |
| Exact Mass | 542.31 |
| IUPAC Name | [1-propanoyloxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (7Z,10Z,13Z)-hexadeca-7,10,13-trienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCC(=O)OC(COC(=O)CC)COC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C28H46O10/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-24(31)37-21(19-35-23(30)4-2)20-36-28-27(34)26(33)25(32)22(18-29)38-28/h5-6,8-9,11-12,21-22,25-29,32-34H,3-4,7,10,13-20H2,1-2H3/b6-5-,9-8-,12-11- |
| InChIKey | WZGNVLIGSMAASU-AGRJPVHOSA-N |
| XLogP | 2.48 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.67 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|