(Z)-8-octanoyloxytetradec-9-enoic acid

C22H40O4 — CID 138301418

IUPAC(Z)-8-octanoyloxytetradec-9-enoic acid
SMILESCCCC/C=C\C(CCCCCCC(=O)O)OC(=O)CCCCCCC
InChIInChI=1S/C22H40O4/c1-3-5-7-9-15-19-22(25)26-20(16-12-8-6-4-2)17-13-10-11-14-18-21(23)24/h12,16,20H,3-11,13-15,17-19H2,1-2H3,(H,23,24)/b16-12-
InChIKeyXXKOQPRSRQQRKV-VBKFSLOCSA-N
MW368.56 g/mol
LogP6.43
Rot. Bonds18

About (Z)-8-octanoyloxytetradec-9-enoic acid

(Z)-8-octanoyloxytetradec-9-enoic acid (PubChem CID 138301418) has the molecular formula C22H40O4 and a molecular weight of 368.56 g/mol. Its IUPAC name is (Z)-8-octanoyloxytetradec-9-enoic acid.

Molecular Properties

Compound Name(Z)-8-octanoyloxytetradec-9-enoic acid
PubChem CID138301418
Molecular FormulaC22H40O4
Molecular Weight368.56 g/mol
Exact Mass368.29
IUPAC Name(Z)-8-octanoyloxytetradec-9-enoic acid
SMILESCCCC/C=C\C(CCCCCCC(=O)O)OC(=O)CCCCCCC
InChIInChI=1S/C22H40O4/c1-3-5-7-9-15-19-22(25)26-20(16-12-8-6-4-2)17-13-10-11-14-18-21(23)24/h12,16,20H,3-11,13-15,17-19H2,1-2H3,(H,23,24)/b16-12-
InChIKeyXXKOQPRSRQQRKV-VBKFSLOCSA-N
XLogP6.43
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds18
Heavy Atoms26
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500368.56
LogP ≤ 56.43
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (Z)-8-octanoyloxytetradec-9-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(Z)-8-tetracosanoyloxytetradec-9-enoic acid
CID 138171715
(Z)-8-pentacosanoyloxytetradec-9-enoic acid
CID 138153651
(Z)-8-dodecanoyloxyheptadec-9-enoic acid
CID 138124028
(Z)-8-octanoyloxyhexadec-9-enoic acid
CID 138206597
(Z)-8-decanoyloxyoctadec-9-enoic acid
CID 138303671
(Z)-8-dodecanoyloxyoctadec-9-enoic acid
CID 138218220
(Z)-8-heptanoyloxynonadec-9-enoic acid
CID 138314262
(Z)-8-octadecanoyloxyhexadec-9-enoic acid
CID 138144670
(Z)-8-pentacosanoyloxynonadec-9-enoic acid
CID 138269638
(Z)-8-[(Z)-icos-11-enoyl]oxyheptadec-9-enoic acid
CID 138235841
(Z)-10-[(Z)-heptadec-9-enoyl]oxyhenicos-11-enoic acid
CID 138195146
(Z)-8-hexacosanoyloxytridec-9-enoic acid
CID 138282371

Frequently Asked Questions

What is the IUPAC name of (Z)-8-octanoyloxytetradec-9-enoic acid?
The IUPAC name of (Z)-8-octanoyloxytetradec-9-enoic acid (CID 138301418) is (Z)-8-octanoyloxytetradec-9-enoic acid.
What is the SMILES notation for (Z)-8-octanoyloxytetradec-9-enoic acid?
The canonical SMILES for (Z)-8-octanoyloxytetradec-9-enoic acid is CCCC/C=C\C(CCCCCCC(=O)O)OC(=O)CCCCCCC.
What is the InChIKey of (Z)-8-octanoyloxytetradec-9-enoic acid?
The InChIKey is XXKOQPRSRQQRKV-VBKFSLOCSA-N. The full InChI is InChI=1S/C22H40O4/c1-3-5-7-9-15-19-22(25)26-20(16-12-8-6-4-2)17-13-10-11-14-18-21(23)24/h12,16,20H,3-11,13-15,17-19H2,1-2H3,(H,23,24)/b16-12-.
What are the key properties of (Z)-8-octanoyloxytetradec-9-enoic acid?
(Z)-8-octanoyloxytetradec-9-enoic acid has a molecular weight of 368.56 g/mol, XLogP of 6.43, 18 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-8-octanoyloxytetradec-9-enoic acid is sourced from PubChem (CID 138301418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).