C48H80O6 — CID 138301748
[3-[(Z)-dodec-5-enoyl]oxy-2-[(6Z,9Z,12Z)-pentadeca-6,9,12-trienoyl]oxypropyl] (10Z,12Z)-octadeca-10,12-dienoate (PubChem CID 138301748) has the molecular formula C48H80O6 and a molecular weight of 753.16 g/mol. Its IUPAC name is [3-[(Z)-dodec-5-enoyl]oxy-2-[(6Z,9Z,12Z)-pentadeca-6,9,12-trienoyl]oxypropyl] (10Z,12Z)-octadeca-10,12-dienoate.
| Compound Name | [3-[(Z)-dodec-5-enoyl]oxy-2-[(6Z,9Z,12Z)-pentadeca-6,9,12-trienoyl]oxypropyl] (10Z,12Z)-octadeca-10,12-dienoate |
|---|---|
| PubChem CID | 138301748 |
| Molecular Formula | C48H80O6 |
| Molecular Weight | 753.16 g/mol |
| Exact Mass | 752.60 |
| IUPAC Name | [3-[(Z)-dodec-5-enoyl]oxy-2-[(6Z,9Z,12Z)-pentadeca-6,9,12-trienoyl]oxypropyl] (10Z,12Z)-octadeca-10,12-dienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCC(=O)OC(COC(=O)CCC/C=C\CCCCCC)COC(=O)CCCCCCCC/C=C\C=C/CCCCC |
| InChI | InChI=1S/C48H80O6/c1-4-7-10-13-16-19-21-23-24-25-27-29-32-35-38-41-47(50)53-44-45(43-52-46(49)40-37-34-31-28-18-15-12-9-6-3)54-48(51)42-39-36-33-30-26-22-20-17-14-11-8-5-2/h8,11,16-17,19-21,23,26,28,30-31,45H,4-7,9-10,12-15,18,22,24-25,27,29,32-44H2,1-3H3/b11-8-,19-16-,20-17-,23-21-,30-26-,31-28- |
| InChIKey | XYNUMKQJIZCFHZ-NJDPVMJESA-N |
| XLogP | 13.91 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.16 |
| LogP ≤ 5 | 13.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|