C55H96O6 — CID 138302369
2,3-bis[[(Z)-hexadec-7-enoyl]oxy]propyl (5Z,8Z,11Z)-icosa-5,8,11-trienoate (PubChem CID 138302369) has the molecular formula C55H96O6 and a molecular weight of 853.37 g/mol. Its IUPAC name is 2,3-bis[[(Z)-hexadec-7-enoyl]oxy]propyl (5Z,8Z,11Z)-icosa-5,8,11-trienoate.
| Compound Name | 2,3-bis[[(Z)-hexadec-7-enoyl]oxy]propyl (5Z,8Z,11Z)-icosa-5,8,11-trienoate |
|---|---|
| PubChem CID | 138302369 |
| Molecular Formula | C55H96O6 |
| Molecular Weight | 853.37 g/mol |
| Exact Mass | 852.72 |
| IUPAC Name | 2,3-bis[[(Z)-hexadec-7-enoyl]oxy]propyl (5Z,8Z,11Z)-icosa-5,8,11-trienoate |
| SMILES | CCCCCCCC/C=C\C/C=C\C/C=C\CCCC(=O)OCC(COC(=O)CCCCC/C=C\CCCCCCCC)OC(=O)CCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C55H96O6/c1-4-7-10-13-16-19-22-25-26-27-28-31-33-36-39-42-45-48-54(57)60-51-52(61-55(58)49-46-43-40-37-34-30-24-21-18-15-12-9-6-3)50-59-53(56)47-44-41-38-35-32-29-23-20-17-14-11-8-5-2/h25-26,28-32,34,36,39,52H,4-24,27,33,35,37-38,40-51H2,1-3H3/b26-25-,31-28-,32-29-,34-30-,39-36- |
| InChIKey | YAKIHNUYQYIHQE-GILDEVORSA-N |
| XLogP | 16.87 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.37 |
| LogP ≤ 5 | 16.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|