C40H75NO4 — CID 138305985
(Z)-N-[(8E,12E)-1,3,4-trihydroxyoctadeca-8,12-dien-2-yl]docos-11-enamide (PubChem CID 138305985) has the molecular formula C40H75NO4 and a molecular weight of 634.04 g/mol. Its IUPAC name is (Z)-N-[(8E,12E)-1,3,4-trihydroxyoctadeca-8,12-dien-2-yl]docos-11-enamide.
| Compound Name | (Z)-N-[(8E,12E)-1,3,4-trihydroxyoctadeca-8,12-dien-2-yl]docos-11-enamide |
|---|---|
| PubChem CID | 138305985 |
| Molecular Formula | C40H75NO4 |
| Molecular Weight | 634.04 g/mol |
| Exact Mass | 633.57 |
| IUPAC Name | (Z)-N-[(8E,12E)-1,3,4-trihydroxyoctadeca-8,12-dien-2-yl]docos-11-enamide |
| SMILES | CCCCC/C=C/CC/C=C/CCCC(O)C(O)C(CO)NC(=O)CCCCCCCCC/C=C\CCCCCCCCCC |
| InChI | InChI=1S/C40H75NO4/c1-3-5-7-9-11-13-15-17-18-19-20-21-22-23-25-27-29-31-33-35-39(44)41-37(36-42)40(45)38(43)34-32-30-28-26-24-16-14-12-10-8-6-4-2/h12,14,19-20,26,28,37-38,40,42-43,45H,3-11,13,15-18,21-25,27,29-36H2,1-2H3,(H,41,44)/b14-12+,20-19-,28-26+ |
| InChIKey | YLQVPLNBMQEJPT-OGPOEGHKSA-N |
| XLogP | 10.43 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.04 |
| LogP ≤ 5 | 10.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|