C20H32O4 — CID 138309356
2-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxybutanoic acid (PubChem CID 138309356) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is 2-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxybutanoic acid.
| Compound Name | 2-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxybutanoic acid |
|---|---|
| PubChem CID | 138309356 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | 2-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxybutanoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCC(=O)OC(CC)C(=O)O |
| InChI | InChI=1S/C20H32O4/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-19(21)24-18(4-2)20(22)23/h5-6,8-9,11-12,18H,3-4,7,10,13-17H2,1-2H3,(H,22,23)/b6-5-,9-8-,12-11- |
| InChIKey | YWGUVFXKDBTXSY-AGRJPVHOSA-N |
| XLogP | 5.20 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|