C49H91NO8P+ — CID 138309619
2-[[2-[(11Z,14Z)-henicosa-11,14-dienoyl]oxy-3-[(11Z,14Z)-icosa-11,14-dienoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 138309619) has the molecular formula C49H91NO8P+ and a molecular weight of 853.24 g/mol. Its IUPAC name is 2-[[2-[(11Z,14Z)-henicosa-11,14-dienoyl]oxy-3-[(11Z,14Z)-icosa-11,14-dienoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[2-[(11Z,14Z)-henicosa-11,14-dienoyl]oxy-3-[(11Z,14Z)-icosa-11,14-dienoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 138309619 |
| Molecular Formula | C49H91NO8P+ |
| Molecular Weight | 853.24 g/mol |
| Exact Mass | 852.65 |
| IUPAC Name | 2-[[2-[(11Z,14Z)-henicosa-11,14-dienoyl]oxy-3-[(11Z,14Z)-icosa-11,14-dienoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCCC(=O)OCC(COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CCCCCCCCC/C=C\C/C=C\CCCCCC |
| InChI | InChI=1S/C49H90NO8P/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-38-40-42-49(52)58-47(46-57-59(53,54)56-44-43-50(3,4)5)45-55-48(51)41-39-37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2/h15-18,21-24,47H,6-14,19-20,25-46H2,1-5H3/p+1/b17-15-,18-16-,23-21-,24-22- |
| InChIKey | YXCQFZWWZUIFHW-MLLZQYMOSA-O |
| XLogP | 13.86 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.24 |
| LogP ≤ 5 | 13.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|