About tributylphosphane
tributylphosphane (PubChem CID 13831) has the molecular formula C12H27P
and a molecular weight of 202.32 g/mol. Its IUPAC name is tributylphosphane.
Molecular Properties
| Compound Name | tributylphosphane |
| PubChem CID | 13831 |
| Molecular Formula | C12H27P |
| Molecular Weight | 202.32 g/mol |
| Exact Mass | 202.19 |
| IUPAC Name | tributylphosphane |
| SMILES | CCCCP(CCCC)CCCC |
| InChI | InChI=1S/C12H27P/c1-4-7-10-13(11-8-5-2)12-9-6-3/h4-12H2,1-3H3 |
| InChIKey | TUQOTMZNTHZOKS-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.32 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tributylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributylphosphane?
The IUPAC name of tributylphosphane (CID 13831) is tributylphosphane.
What is the SMILES notation for tributylphosphane?
The canonical SMILES for tributylphosphane is CCCCP(CCCC)CCCC.
What is the InChIKey of tributylphosphane?
The InChIKey is TUQOTMZNTHZOKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27P/c1-4-7-10-13(11-8-5-2)12-9-6-3/h4-12H2,1-3H3.
What are the key properties of tributylphosphane?
tributylphosphane has a molecular weight of 202.32 g/mol, XLogP of 4.87, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tributylphosphane is sourced from PubChem (CID 13831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).