C51H88O6 — CID 138310352
[2-[(9Z,12Z)-pentadeca-9,12-dienoyl]oxy-3-[(Z)-pentadec-9-enoyl]oxypropyl] (10Z,12Z)-octadeca-10,12-dienoate (PubChem CID 138310352) has the molecular formula C51H88O6 and a molecular weight of 797.26 g/mol. Its IUPAC name is [2-[(9Z,12Z)-pentadeca-9,12-dienoyl]oxy-3-[(Z)-pentadec-9-enoyl]oxypropyl] (10Z,12Z)-octadeca-10,12-dienoate.
| Compound Name | [2-[(9Z,12Z)-pentadeca-9,12-dienoyl]oxy-3-[(Z)-pentadec-9-enoyl]oxypropyl] (10Z,12Z)-octadeca-10,12-dienoate |
|---|---|
| PubChem CID | 138310352 |
| Molecular Formula | C51H88O6 |
| Molecular Weight | 797.26 g/mol |
| Exact Mass | 796.66 |
| IUPAC Name | [2-[(9Z,12Z)-pentadeca-9,12-dienoyl]oxy-3-[(Z)-pentadec-9-enoyl]oxypropyl] (10Z,12Z)-octadeca-10,12-dienoate |
| SMILES | CC/C=C\C/C=C\CCCCCCCC(=O)OC(COC(=O)CCCCCCC/C=C\CCCCC)COC(=O)CCCCCCCC/C=C\C=C/CCCCC |
| InChI | InChI=1S/C51H88O6/c1-4-7-10-13-16-19-22-25-26-27-30-32-35-38-41-44-50(53)56-47-48(57-51(54)45-42-39-36-33-29-24-21-18-15-12-9-6-3)46-55-49(52)43-40-37-34-31-28-23-20-17-14-11-8-5-2/h9,12,16-22,25,48H,4-8,10-11,13-15,23-24,26-47H2,1-3H3/b12-9-,19-16-,20-17-,21-18-,25-22- |
| InChIKey | YZJLESRAAIEFCP-DNTJRMDISA-N |
| XLogP | 15.31 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.26 |
| LogP ≤ 5 | 15.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|