C43H82N2O6P+ — CID 138311071
2-[hydroxy-[(4E,8E)-3-hydroxy-2-[[(11Z,14Z)-icosa-11,14-dienoyl]amino]octadeca-4,8-dienoxy]phosphoryl]oxyethyl-trimethylazanium (PubChem CID 138311071) has the molecular formula C43H82N2O6P+ and a molecular weight of 754.11 g/mol. Its IUPAC name is 2-[hydroxy-[(4E,8E)-3-hydroxy-2-[[(11Z,14Z)-icosa-11,14-dienoyl]amino]octadeca-4,8-dienoxy]phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-[(4E,8E)-3-hydroxy-2-[[(11Z,14Z)-icosa-11,14-dienoyl]amino]octadeca-4,8-dienoxy]phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 138311071 |
| Molecular Formula | C43H82N2O6P+ |
| Molecular Weight | 754.11 g/mol |
| Exact Mass | 753.59 |
| IUPAC Name | 2-[hydroxy-[(4E,8E)-3-hydroxy-2-[[(11Z,14Z)-icosa-11,14-dienoyl]amino]octadeca-4,8-dienoxy]phosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCCC(=O)NC(COP(=O)(O)OCC[N+](C)(C)C)C(O)/C=C/CC/C=C/CCCCCCCCC |
| InChI | InChI=1S/C43H81N2O6P/c1-6-8-10-12-14-16-18-20-21-22-23-25-27-29-31-33-35-37-43(47)44-41(40-51-52(48,49)50-39-38-45(3,4)5)42(46)36-34-32-30-28-26-24-19-17-15-13-11-9-7-2/h14,16,20-21,26,28,34,36,41-42,46H,6-13,15,17-19,22-25,27,29-33,35,37-40H2,1-5H3,(H-,44,47,48,49)/p+1/b16-14-,21-20-,28-26+,36-34+ |
| InChIKey | ZBPCEAWXGFUQAS-BBUXUTTPSA-O |
| XLogP | 11.30 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.11 |
| LogP ≤ 5 | 11.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|