C29H51O10P — CID 138315810
[1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-heptanoyloxypropan-2-yl] (7Z,10Z,13Z)-hexadeca-7,10,13-trienoate (PubChem CID 138315810) has the molecular formula C29H51O10P and a molecular weight of 590.69 g/mol. Its IUPAC name is [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-heptanoyloxypropan-2-yl] (7Z,10Z,13Z)-hexadeca-7,10,13-trienoate.
| Compound Name | [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-heptanoyloxypropan-2-yl] (7Z,10Z,13Z)-hexadeca-7,10,13-trienoate |
|---|---|
| PubChem CID | 138315810 |
| Molecular Formula | C29H51O10P |
| Molecular Weight | 590.69 g/mol |
| Exact Mass | 590.32 |
| IUPAC Name | [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-heptanoyloxypropan-2-yl] (7Z,10Z,13Z)-hexadeca-7,10,13-trienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCC(=O)OC(COC(=O)CCCCCC)COP(=O)(O)OCC(O)CO |
| InChI | InChI=1S/C29H51O10P/c1-3-5-7-9-10-11-12-13-14-15-16-17-19-21-29(33)39-27(24-36-28(32)20-18-8-6-4-2)25-38-40(34,35)37-23-26(31)22-30/h5,7,10-11,13-14,26-27,30-31H,3-4,6,8-9,12,15-25H2,1-2H3,(H,34,35)/b7-5-,11-10-,14-13- |
| InChIKey | ZQFVWXAFAQSRSH-LNCSVHMCSA-N |
| XLogP | 5.71 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.69 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|