C47H80O6 — CID 138316557
[3-[(6Z,9Z)-dodeca-6,9-dienoyl]oxy-2-[(7Z,9Z)-tetradeca-7,9-dienoyl]oxypropyl] (Z)-octadec-11-enoate (PubChem CID 138316557) has the molecular formula C47H80O6 and a molecular weight of 741.15 g/mol. Its IUPAC name is [3-[(6Z,9Z)-dodeca-6,9-dienoyl]oxy-2-[(7Z,9Z)-tetradeca-7,9-dienoyl]oxypropyl] (Z)-octadec-11-enoate.
| Compound Name | [3-[(6Z,9Z)-dodeca-6,9-dienoyl]oxy-2-[(7Z,9Z)-tetradeca-7,9-dienoyl]oxypropyl] (Z)-octadec-11-enoate |
|---|---|
| PubChem CID | 138316557 |
| Molecular Formula | C47H80O6 |
| Molecular Weight | 741.15 g/mol |
| Exact Mass | 740.60 |
| IUPAC Name | [3-[(6Z,9Z)-dodeca-6,9-dienoyl]oxy-2-[(7Z,9Z)-tetradeca-7,9-dienoyl]oxypropyl] (Z)-octadec-11-enoate |
| SMILES | CC/C=C\C/C=C\CCCCC(=O)OCC(COC(=O)CCCCCCCCC/C=C\CCCCCC)OC(=O)CCCCC/C=C\C=C/CCCC |
| InChI | InChI=1S/C47H80O6/c1-4-7-10-13-16-19-21-22-23-24-26-28-31-34-37-40-46(49)52-43-44(42-51-45(48)39-36-33-30-27-18-15-12-9-6-3)53-47(50)41-38-35-32-29-25-20-17-14-11-8-5-2/h9,12,14,17-21,25,27,44H,4-8,10-11,13,15-16,22-24,26,28-43H2,1-3H3/b12-9-,17-14-,21-19-,25-20-,27-18- |
| InChIKey | ZSLNFIIXTMIPAY-PJXIDYFOSA-N |
| XLogP | 13.75 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.15 |
| LogP ≤ 5 | 13.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|