C19H38NO8P — CID 138317380
[1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-butanoyloxypropan-2-yl] decanoate (PubChem CID 138317380) has the molecular formula C19H38NO8P and a molecular weight of 439.49 g/mol. Its IUPAC name is [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-butanoyloxypropan-2-yl] decanoate.
| Compound Name | [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-butanoyloxypropan-2-yl] decanoate |
|---|---|
| PubChem CID | 138317380 |
| Molecular Formula | C19H38NO8P |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-butanoyloxypropan-2-yl] decanoate |
| SMILES | CCCCCCCCCC(=O)OC(COC(=O)CCC)COP(=O)(O)OCCN |
| InChI | InChI=1S/C19H38NO8P/c1-3-5-6-7-8-9-10-12-19(22)28-17(15-25-18(21)11-4-2)16-27-29(23,24)26-14-13-20/h17H,3-16,20H2,1-2H3,(H,23,24) |
| InChIKey | ZVCDYXHHGIRUTO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 134.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|