About (2-sulfanylidene-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)methanamine
(2-sulfanylidene-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)methanamine (PubChem CID 138319392) has the molecular formula C8H10NO2PS
and a molecular weight of 215.21 g/mol. Its IUPAC name is (2-sulfanylidene-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)methanamine.
Molecular Properties
| Compound Name | (2-sulfanylidene-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)methanamine |
| PubChem CID | 138319392 |
| Molecular Formula | C8H10NO2PS |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.02 |
| IUPAC Name | (2-sulfanylidene-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)methanamine |
| SMILES | NCP1(=S)OCc2ccccc2O1 |
| InChI | InChI=1S/C8H10NO2PS/c9-6-12(13)10-5-7-3-1-2-4-8(7)11-12/h1-4H,5-6,9H2 |
| InChIKey | OZQVMZGTIQMSPW-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2-sulfanylidene-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-sulfanylidene-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)methanamine?
The IUPAC name of (2-sulfanylidene-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)methanamine (CID 138319392) is (2-sulfanylidene-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)methanamine.
What is the SMILES notation for (2-sulfanylidene-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)methanamine?
The canonical SMILES for (2-sulfanylidene-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)methanamine is NCP1(=S)OCc2ccccc2O1.
What is the InChIKey of (2-sulfanylidene-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)methanamine?
The InChIKey is OZQVMZGTIQMSPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10NO2PS/c9-6-12(13)10-5-7-3-1-2-4-8(7)11-12/h1-4H,5-6,9H2.
What are the key properties of (2-sulfanylidene-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)methanamine?
(2-sulfanylidene-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)methanamine has a molecular weight of 215.21 g/mol, XLogP of 1.82, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-sulfanylidene-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)methanamine is sourced from PubChem (CID 138319392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).