About 2-[4-[2-[(E)-but-2-enoyl]oxyethyl]piperazin-1-yl]ethyl (E)-but-2-enoate;dihydrochloride
2-[4-[2-[(E)-but-2-enoyl]oxyethyl]piperazin-1-yl]ethyl (E)-but-2-enoate;dihydrochloride (PubChem CID 138319434) has the molecular formula C16H28Cl2N2O4
and a molecular weight of 383.32 g/mol. Its IUPAC name is 2-[4-[2-[(E)-but-2-enoyl]oxyethyl]piperazin-1-yl]ethyl (E)-but-2-enoate;dihydrochloride.
Molecular Properties
| Compound Name | 2-[4-[2-[(E)-but-2-enoyl]oxyethyl]piperazin-1-yl]ethyl (E)-but-2-enoate;dihydrochloride |
| PubChem CID | 138319434 |
| Molecular Formula | C16H28Cl2N2O4 |
| Molecular Weight | 383.32 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 2-[4-[2-[(E)-but-2-enoyl]oxyethyl]piperazin-1-yl]ethyl (E)-but-2-enoate;dihydrochloride |
| SMILES | C/C=C/C(=O)OCCN1CCN(CCOC(=O)/C=C/C)CC1.Cl.Cl |
| InChI | InChI=1S/C16H26N2O4.2ClH/c1-3-5-15(19)21-13-11-17-7-9-18(10-8-17)12-14-22-16(20)6-4-2;;/h3-6H,7-14H2,1-2H3;2*1H/b5-3+,6-4+;; |
| InChIKey | VBBSDDVKQORLEP-ZOGBMKMPSA-N |
| XLogP | 1.69 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.32 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[2-[(E)-but-2-enoyl]oxyethyl]piperazin-1-yl]ethyl (E)-but-2-enoate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[2-[(E)-but-2-enoyl]oxyethyl]piperazin-1-yl]ethyl (E)-but-2-enoate;dihydrochloride?
The IUPAC name of 2-[4-[2-[(E)-but-2-enoyl]oxyethyl]piperazin-1-yl]ethyl (E)-but-2-enoate;dihydrochloride (CID 138319434) is 2-[4-[2-[(E)-but-2-enoyl]oxyethyl]piperazin-1-yl]ethyl (E)-but-2-enoate;dihydrochloride.
What is the SMILES notation for 2-[4-[2-[(E)-but-2-enoyl]oxyethyl]piperazin-1-yl]ethyl (E)-but-2-enoate;dihydrochloride?
The canonical SMILES for 2-[4-[2-[(E)-but-2-enoyl]oxyethyl]piperazin-1-yl]ethyl (E)-but-2-enoate;dihydrochloride is C/C=C/C(=O)OCCN1CCN(CCOC(=O)/C=C/C)CC1.Cl.Cl.
What is the InChIKey of 2-[4-[2-[(E)-but-2-enoyl]oxyethyl]piperazin-1-yl]ethyl (E)-but-2-enoate;dihydrochloride?
The InChIKey is VBBSDDVKQORLEP-ZOGBMKMPSA-N. The full InChI is InChI=1S/C16H26N2O4.2ClH/c1-3-5-15(19)21-13-11-17-7-9-18(10-8-17)12-14-22-16(20)6-4-2;;/h3-6H,7-14H2,1-2H3;2*1H/b5-3+,6-4+;;.
What are the key properties of 2-[4-[2-[(E)-but-2-enoyl]oxyethyl]piperazin-1-yl]ethyl (E)-but-2-enoate;dihydrochloride?
2-[4-[2-[(E)-but-2-enoyl]oxyethyl]piperazin-1-yl]ethyl (E)-but-2-enoate;dihydrochloride has a molecular weight of 383.32 g/mol, XLogP of 1.69, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[2-[(E)-but-2-enoyl]oxyethyl]piperazin-1-yl]ethyl (E)-but-2-enoate;dihydrochloride is sourced from PubChem (CID 138319434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).